Q: Without re-deriving, what is dxdsin(2x) from first principles structure? (Hint: sin(2x+2h)...)
A: The same proof with h→2h effectively scales by the inner rate: you'd get 2cos(2x). The factor 2 comes from hsin2h→2. This previews the chain rule.
The Squeeze (Sandwich) Theorem via unit-circle areas
Three areas compared in the squeeze?
21sinh≤21h≤21tanh
Addition formula used for sin?
sin(x+h)=sinxcosh+cosxsinh
Addition formula used for cos?
cos(x+h)=cosxcosh−sinxsinh
dxdsinx?
cosx
dxdcosx?
−sinx
Why must angles be in radians?
Because hsinh→1 only holds in radians (sector area =21h)
Trick to evaluate hcosh−1?
Multiply by conjugate cosh+1cosh+1
Why can't we use L'Hôpital here?
It assumes dxdsinx=cosx — circular
Recall Feynman: explain to a 12-year-old
Imagine pushing a swing. When the swing is at the very bottom it's moving fastest; at the top it stops for a moment. The height of the swing is like sinx, and how fast it's moving is like cosx. Notice: when height is in the middle (zero), speed is biggest — and when height is at the top, speed is zero. Differentiation is just asking "how fast is it changing right now?" For sine, that answer is always the cosine. To prove it we zoom in super close (that's the limit), use a circle to show a tiny angle and its sine are nearly equal, and the algebra clicks into place.
Dekho, idea simple hai: agar sinx ek lehar (wave) hai, to uska rate of change yaani derivative ek aur wave nikalti hai — aur wo wave exactly cosx hai. Matlab differentiation ne sirf wave ko 90 degree shift kar diya. Aur cosx ka derivative −sinx, kyunki cosine apne peak par decrease hona shuru karta hai, isliye minus aata hai.
Proof ka dil do limits hain. Pehla: hsinh→1 jab h chhota hota hai. Yeh hum unit circle mein teen area compare karke (triangle ≤ sector ≤ bada triangle) Squeeze Theorem se prove karte hain. Yaad rakho yeh sirf radians mein sach hai — degrees mein galat ho jayega, isliye calculus hamesha radians use karti hai. Dusra limit: hcosh−1→0, jise hum conjugate (cosh+1) se multiply karke nikaalte hain.
Ab actual derivative: sin(x+h) ko addition formula se khol do — sinxcosh+cosxsinh. Phir sinx wale terms group karke do known limits (0 aur 1) plug kar do, aur seedha cosx aa jata hai. Cosine ke liye bilkul same kaam, bas sign flip hone se −sinx milta hai.
Important warning: L'Hôpital rule mat lagana hsinh par — kyunki uske liye pehle se dxdsinx=cosx chahiye, jo hum prove hi kar rahe hain. Yeh circular logic hai. Bas Squeeze + addition formula — yeh 80/20 hai, inhe pakad lo to poora proof 1 minute mein khud bana loge.