3.1.12Advanced Trigonometry

Sum and difference formulas — sin(A±B), cos(A±B), tan(A±B) — proofs

1,880 words9 min readdifficulty · medium1 backlinks

1. What we are proving

Notice the sign gymnastics: in cosine the signs flip (plus outside → minus inside), in sine the signs match. That pattern is the whole memory game.


2. Derivation from scratch — the unit-circle / distance method

We prove ==cos(AB)\cos(A-B)== first, because everything else falls out of it.

Figure — Sum and difference formulas — sin(A±B), cos(A±B), tan(A±B) — proofs

Step 1 — Place the points

On the unit circle:

  • P=(cosA,sinA)P = (\cos A, \sin A)
  • Q=(cosB,sinB)Q = (\cos B, \sin B)

Why this step? By definition, a point at angle θ\theta on the unit circle has coordinates (cosθ,sinθ)(\cos\theta,\sin\theta). This encodes the angles as geometry.

Step 2 — Chord length via coordinates (distance formula)

PQ2=(cosAcosB)2+(sinAsinB)2PQ^2 = (\cos A-\cos B)^2 + (\sin A - \sin B)^2 Expand: =cos2A2cosAcosB+cos2B+sin2A2sinAsinB+sin2B= \cos^2 A - 2\cos A\cos B + \cos^2 B + \sin^2 A - 2\sin A\sin B + \sin^2 B Group using cos2θ+sin2θ=1\cos^2\theta+\sin^2\theta=1: =(cos2A+sin2A)1+(cos2B+sin2B)12(cosAcosB+sinAsinB)= \underbrace{(\cos^2 A+\sin^2 A)}_{1} + \underbrace{(\cos^2 B+\sin^2 B)}_{1} - 2(\cos A\cos B + \sin A\sin B) PQ2=22(cosAcosB+sinAsinB)\boxed{PQ^2 = 2 - 2(\cos A\cos B + \sin A\sin B)}

Why this step? The Pythagorean identity collapses four squared terms into a clean constant, leaving only the cross-terms — which is exactly what our formula is about.

Step 3 — Chord length via the angle between them

The angle from QQ to PP is (AB)(A-B). Rotate the whole picture so QQ sits at angle 00, i.e. at (1,0)(1,0), and PP sits at angle (AB)(A-B), i.e. at (cos(AB),sin(AB))(\cos(A-B),\sin(A-B)). Rotation doesn't change distances, so: PQ2=(cos(AB)1)2+(sin(AB)0)2PQ^2 = (\cos(A-B)-1)^2 + (\sin(A-B)-0)^2 =cos2(AB)2cos(AB)+1+sin2(AB)= \cos^2(A-B) - 2\cos(A-B) + 1 + \sin^2(A-B) =12cos(AB)+1=22cos(AB)= 1 - 2\cos(A-B) + 1 = 2 - 2\cos(A-B)

Why this step? Distance is invariant under rotation, so the same chord can be measured after simplifying the geometry — now only (AB)(A-B) appears.

Step 4 — Equate the two expressions

22cos(AB)=22(cosAcosB+sinAsinB)2 - 2\cos(A-B) = 2 - 2(\cos A\cos B + \sin A\sin B) cos(AB)=cosAcosB+sinAsinB\therefore \cos(A-B) = \cos A\cos B + \sin A\sin B \quad\checkmark


3. Getting the other five for free


4. Worked examples


5. Forecast-then-Verify

Recall Predict before expanding: what is

cos(A+B)+cos(AB)\cos(A+B)+\cos(A-B)? Forecast a product... Expand: (cosAcosBsinAsinB)+(cosAcosB+sinAsinB)=2cosAcosB(\cos A\cos B - \sin A\sin B)+(\cos A\cos B + \sin A\sin B) = 2\cos A\cos B The sinsin\sin\sin terms cancel → this is the product-to-sum identity. Sums of these formulas kill half the terms; that's the engine behind all product-to-sum results.


6. Common mistakes (Steel-manned)


7. Flashcards

What identity is proved first, and by what method?
cos(AB)=cosAcosB+sinAsinB\cos(A-B)=\cos A\cos B+\sin A\sin B, via the chord/distance formula on the unit circle.
State sin(A+B)\sin(A+B).
sinAcosB+cosAsinB\sin A\cos B + \cos A\sin B
State cos(A+B)\cos(A+B).
cosAcosBsinAsinB\cos A\cos B - \sin A\sin B (signs flip).
State tan(AB)\tan(A-B).
tanAtanB1+tanAtanB\dfrac{\tan A - \tan B}{1+\tan A\tan B}
How do you get cos(A+B)\cos(A+B) from cos(AB)\cos(A-B)?
Replace BBB\to -B and use cos\cos even, sin\sin odd.
How do you turn cosine formula into sine formula?
Cofunction: sinθ=cos(π2θ)\sin\theta=\cos(\tfrac{\pi}{2}-\theta).
Why divide by cosAcosB\cos A\cos B in the tangent proof?
To convert every sin/cos\sin/\cos ratio into a tan\tan.
Exact sin75°\sin75°?
6+24\dfrac{\sqrt6+\sqrt2}{4}
One-line reason sin(A+B)sinA+sinB\sin(A+B)\ne\sin A+\sin B?
Sine encodes rotation, not a linear scaling.

Recall Feynman: explain to a 12-year-old

Imagine a clock hand spinning. Turning it by angle AA and then a bit more by angle BB ends in the same place as turning it by A+BA+B all at once. The sine and cosine are just the "height" and "sideways" positions of the tip. These formulas are the recipe that says: to find the new height/sideways after both turns, mix the heights and sideways of each turn together. That's why the answer isn't just adding them — the two turns get stirred together, some parts adding, some subtracting.

Connections

Concept Map

distance formula

rotate so Q at origin

simplifies squares

equate

equate

replace B with -B

cofunction shift

divide by cos

divide by cos

enables

enables

Unit circle points P and Q

Chord PQ via distance formula

Chord PQ via rotation angle A-B

Pythagorean identity

cos of A minus B

cos of A plus B

sin of A plus or minus B

tan of A plus or minus B

Applications - nice angles, calculus, double-angle

Hinglish (regional understanding)

Intuition Hinglish mein samjho

Dekho, in formulas ka core idea simple hai: agar tumhe do alag angles AA aur BB ke sine-cosine pata hain, to tum unke combined angle A+BA+B ka sine-cosine nikal sakte ho. Kyun? Kyunki circle pe angle AA ghumana phir BB ghumana, ekdum A+BA+B ghumane ke barabar hai. Yeh formulas basically "rotation ka algebra" hain.

Proof ka asli jugaad yeh hai: unit circle pe do points rakho angle AA aur BB par. Unke beech ki chord (seedhi line) ki length sirf (AB)(A-B) pe depend karti hai. Ab chord length ko do tareeke se nikalo — ek baar distance formula se (coordinates use karke), doosri baar picture ko ghuma ke jahan ek point (1,0)(1,0) pe aa jaye. Dono expressions equal karo, aur cos(AB)=cosAcosB+sinAsinB\cos(A-B)=\cos A\cos B+\sin A\sin B apne aap nikal aata hai. Baaki paanch formulas isi se free milte hain — BB ki jagah B-B daalo, ya cofunction sinθ=cos(90°θ)\sin\theta=\cos(90°-\theta) use karo, ya tangent ke liye upar-neeche cosAcosB\cos A\cos B se divide karo.

Ek baat yaad rakhna jo students galat karte hain: sin(A+B)\sin(A+B) kabhi bhi sinA+sinB\sin A+\sin B nahi hota. Test karo A=B=90°A=B=90°: left side =sin180°=0=\sin180°=0, right side =2=2. Bilkul galat! Sine linear nahi hai, woh rotation hai. Aur cosine mein signs ulte hote hain: cos(A+B)=coscossinsin\cos(A+B)=\cos\cos-\sin\sin. Formula: "Cosine is contrary".

Yeh matter kyun karta hai? sin75°\sin75°, cos15°\cos15° jaise exact values, double-angle formulas, calculus mein sinx\sin x ka derivative — sab isi se aate hain. Ek baar proof samajh gaye to ratta maarne ki zaroorat hi nahi.

Go deeper — visual, from zero

Test yourself — Advanced Trigonometry

Connections